C29H23N3O6S2 — CID 5119678
prop-2-enyl 7-methyl-5-(4-methylsulfanylphenyl)-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 5119678) has the molecular formula C29H23N3O6S2 and a molecular weight of 573.65 g/mol. Its IUPAC name is prop-2-enyl 7-methyl-5-(4-methylsulfanylphenyl)-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | prop-2-enyl 7-methyl-5-(4-methylsulfanylphenyl)-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 5119678 |
| Molecular Formula | C29H23N3O6S2 |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.10 |
| IUPAC Name | prop-2-enyl 7-methyl-5-(4-methylsulfanylphenyl)-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)N=c2sc(=Cc3ccc(-c4cccc([N+](=O)[O-])c4)o3)c(=O)n2C1c1ccc(SC)cc1 |
| InChI | InChI=1S/C29H23N3O6S2/c1-4-14-37-28(34)25-17(2)30-29-31(26(25)18-8-11-22(39-3)12-9-18)27(33)24(40-29)16-21-10-13-23(38-21)19-6-5-7-20(15-19)32(35)36/h4-13,15-16,26H,1,14H2,2-3H3 |
| InChIKey | IDCWLNZOOABBQL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 116.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|