C25H24Cl2FN3O2S — CID 22742228
5-[(E)-2-(2-benzylsulfanyl-5-nitrophenyl)ethenyl]-8-fluoro-1-methyl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride (PubChem CID 22742228) has the molecular formula C25H24Cl2FN3O2S and a molecular weight of 520.46 g/mol. Its IUPAC name is 5-[(E)-2-(2-benzylsulfanyl-5-nitrophenyl)ethenyl]-8-fluoro-1-methyl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride.
| Compound Name | 5-[(E)-2-(2-benzylsulfanyl-5-nitrophenyl)ethenyl]-8-fluoro-1-methyl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride |
|---|---|
| PubChem CID | 22742228 |
| Molecular Formula | C25H24Cl2FN3O2S |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 5-[(E)-2-(2-benzylsulfanyl-5-nitrophenyl)ethenyl]-8-fluoro-1-methyl-2,3-dihydro-1,4-benzodiazepine;dihydrochloride |
| SMILES | CN1CCN=C(/C=C/c2cc([N+](=O)[O-])ccc2SCc2ccccc2)c2ccc(F)cc21.Cl.Cl |
| InChI | InChI=1S/C25H22FN3O2S.2ClH/c1-28-14-13-27-23(22-10-8-20(26)16-24(22)28)11-7-19-15-21(29(30)31)9-12-25(19)32-17-18-5-3-2-4-6-18;;/h2-12,15-16H,13-14,17H2,1H3;2*1H/b11-7+;; |
| InChIKey | KFCOQJWJXXVPSH-FCVAESPPSA-N |
| XLogP | 6.82 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|