C18H23N3O2 — CID 156828123
4-benzyl-1-methyl-6-nitro-2,3-dihydroquinoxaline;ethane (PubChem CID 156828123) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-benzyl-1-methyl-6-nitro-2,3-dihydroquinoxaline;ethane.
| Compound Name | 4-benzyl-1-methyl-6-nitro-2,3-dihydroquinoxaline;ethane |
|---|---|
| PubChem CID | 156828123 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 4-benzyl-1-methyl-6-nitro-2,3-dihydroquinoxaline;ethane |
| SMILES | CC.CN1CCN(Cc2ccccc2)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H17N3O2.C2H6/c1-17-9-10-18(12-13-5-3-2-4-6-13)16-11-14(19(20)21)7-8-15(16)17;1-2/h2-8,11H,9-10,12H2,1H3;1-2H3 |
| InChIKey | IRWDLYFMWJZJLY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|