C31H37FN2O5 — CID 22742619
N-benzyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-6-(3-fluoropropoxy)-7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]acetamide (PubChem CID 22742619) has the molecular formula C31H37FN2O5 and a molecular weight of 536.64 g/mol. Its IUPAC name is N-benzyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-6-(3-fluoropropoxy)-7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]acetamide.
| Compound Name | N-benzyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-6-(3-fluoropropoxy)-7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]acetamide |
|---|---|
| PubChem CID | 22742619 |
| Molecular Formula | C31H37FN2O5 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | N-benzyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-6-(3-fluoropropoxy)-7-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]acetamide |
| SMILES | COc1ccc(CC2c3cc(OC)c(OCCCF)cc3CCN2CC(=O)NCc2ccccc2)cc1OC |
| InChI | InChI=1S/C31H37FN2O5/c1-36-27-11-10-23(17-28(27)37-2)16-26-25-19-29(38-3)30(39-15-7-13-32)18-24(25)12-14-34(26)21-31(35)33-20-22-8-5-4-6-9-22/h4-6,8-11,17-19,26H,7,12-16,20-21H2,1-3H3,(H,33,35) |
| InChIKey | IIDGIVMHSLBQQD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|