C33H43N3O3 — CID 122185159
N-benzyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-6-(hexylamino)-3,4-dihydro-1H-isoquinolin-2-yl]acetamide (PubChem CID 122185159) has the molecular formula C33H43N3O3 and a molecular weight of 529.73 g/mol. Its IUPAC name is N-benzyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-6-(hexylamino)-3,4-dihydro-1H-isoquinolin-2-yl]acetamide.
| Compound Name | N-benzyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-6-(hexylamino)-3,4-dihydro-1H-isoquinolin-2-yl]acetamide |
|---|---|
| PubChem CID | 122185159 |
| Molecular Formula | C33H43N3O3 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.33 |
| IUPAC Name | N-benzyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-6-(hexylamino)-3,4-dihydro-1H-isoquinolin-2-yl]acetamide |
| SMILES | CCCCCCNc1ccc2c(c1)CCN(CC(=O)NCc1ccccc1)C2Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C33H43N3O3/c1-4-5-6-10-18-34-28-14-15-29-27(22-28)17-19-36(24-33(37)35-23-25-11-8-7-9-12-25)30(29)20-26-13-16-31(38-2)32(21-26)39-3/h7-9,11-16,21-22,30,34H,4-6,10,17-20,23-24H2,1-3H3,(H,35,37) |
| InChIKey | CUSMDTSIZNVXNX-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|