C36H46N2O6 — CID 122184315
ethyl 7-[[2-[2-(benzylamino)-2-oxoethyl]-1-[(3,4-dimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-yl]oxy]heptanoate (PubChem CID 122184315) has the molecular formula C36H46N2O6 and a molecular weight of 602.77 g/mol. Its IUPAC name is ethyl 7-[[2-[2-(benzylamino)-2-oxoethyl]-1-[(3,4-dimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-yl]oxy]heptanoate.
| Compound Name | ethyl 7-[[2-[2-(benzylamino)-2-oxoethyl]-1-[(3,4-dimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-yl]oxy]heptanoate |
|---|---|
| PubChem CID | 122184315 |
| Molecular Formula | C36H46N2O6 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | ethyl 7-[[2-[2-(benzylamino)-2-oxoethyl]-1-[(3,4-dimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-6-yl]oxy]heptanoate |
| SMILES | CCOC(=O)CCCCCCOc1ccc2c(c1)CCN(CC(=O)NCc1ccccc1)C2Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C36H46N2O6/c1-4-43-36(40)14-10-5-6-11-21-44-30-16-17-31-29(24-30)19-20-38(26-35(39)37-25-27-12-8-7-9-13-27)32(31)22-28-15-18-33(41-2)34(23-28)42-3/h7-9,12-13,15-18,23-24,32H,4-6,10-11,14,19-22,25-26H2,1-3H3,(H,37,39) |
| InChIKey | NEUPPLFOBVIXPQ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|