C32H39N3O3 — CID 122184484
N-benzyl-2-[6-[cyclopropylmethyl(methyl)amino]-1-[(3,4-dimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]acetamide (PubChem CID 122184484) has the molecular formula C32H39N3O3 and a molecular weight of 513.68 g/mol. Its IUPAC name is N-benzyl-2-[6-[cyclopropylmethyl(methyl)amino]-1-[(3,4-dimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]acetamide.
| Compound Name | N-benzyl-2-[6-[cyclopropylmethyl(methyl)amino]-1-[(3,4-dimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]acetamide |
|---|---|
| PubChem CID | 122184484 |
| Molecular Formula | C32H39N3O3 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | N-benzyl-2-[6-[cyclopropylmethyl(methyl)amino]-1-[(3,4-dimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]acetamide |
| SMILES | COc1ccc(CC2c3ccc(N(C)CC4CC4)cc3CCN2CC(=O)NCc2ccccc2)cc1OC |
| InChI | InChI=1S/C32H39N3O3/c1-34(21-24-9-10-24)27-12-13-28-26(19-27)15-16-35(22-32(36)33-20-23-7-5-4-6-8-23)29(28)17-25-11-14-30(37-2)31(18-25)38-3/h4-8,11-14,18-19,24,29H,9-10,15-17,20-22H2,1-3H3,(H,33,36) |
| InChIKey | MXJPAGHWFNGZEO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|