C17H21BrN4O2S — CID 22744892
[4-[3-[(5-bromo-2-methoxyphenyl)methylsulfanyl]pyrazin-2-yl]morpholin-2-yl]methanamine (PubChem CID 22744892) has the molecular formula C17H21BrN4O2S and a molecular weight of 425.35 g/mol. Its IUPAC name is [4-[3-[(5-bromo-2-methoxyphenyl)methylsulfanyl]pyrazin-2-yl]morpholin-2-yl]methanamine.
| Compound Name | [4-[3-[(5-bromo-2-methoxyphenyl)methylsulfanyl]pyrazin-2-yl]morpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 22744892 |
| Molecular Formula | C17H21BrN4O2S |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | [4-[3-[(5-bromo-2-methoxyphenyl)methylsulfanyl]pyrazin-2-yl]morpholin-2-yl]methanamine |
| SMILES | COc1ccc(Br)cc1CSc1nccnc1N1CCOC(CN)C1 |
| InChI | InChI=1S/C17H21BrN4O2S/c1-23-15-3-2-13(18)8-12(15)11-25-17-16(20-4-5-21-17)22-6-7-24-14(9-19)10-22/h2-5,8,14H,6-7,9-11,19H2,1H3 |
| InChIKey | BGUFTVURYNRKEY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |