C20H19N3O3 — CID 22745126
ethyl 3-[(2-methylquinolin-4-yl)carbamoylamino]benzoate (PubChem CID 22745126) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is ethyl 3-[(2-methylquinolin-4-yl)carbamoylamino]benzoate.
| Compound Name | ethyl 3-[(2-methylquinolin-4-yl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 22745126 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | ethyl 3-[(2-methylquinolin-4-yl)carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)Nc2cc(C)nc3ccccc23)c1 |
| InChI | InChI=1S/C20H19N3O3/c1-3-26-19(24)14-7-6-8-15(12-14)22-20(25)23-18-11-13(2)21-17-10-5-4-9-16(17)18/h4-12H,3H2,1-2H3,(H2,21,22,23,25) |
| InChIKey | UYOHTCCLXICITI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |