C15H16F2N2O4S — CID 22746722
4-(3-cyclohexyl-2-oxo-1,3-oxazol-4-yl)-2,5-difluorobenzenesulfonamide (PubChem CID 22746722) has the molecular formula C15H16F2N2O4S and a molecular weight of 358.37 g/mol. Its IUPAC name is 4-(3-cyclohexyl-2-oxo-1,3-oxazol-4-yl)-2,5-difluorobenzenesulfonamide.
| Compound Name | 4-(3-cyclohexyl-2-oxo-1,3-oxazol-4-yl)-2,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 22746722 |
| Molecular Formula | C15H16F2N2O4S |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 4-(3-cyclohexyl-2-oxo-1,3-oxazol-4-yl)-2,5-difluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(F)c(-c2coc(=O)n2C2CCCCC2)cc1F |
| InChI | InChI=1S/C15H16F2N2O4S/c16-11-7-14(24(18,21)22)12(17)6-10(11)13-8-23-15(20)19(13)9-4-2-1-3-5-9/h6-9H,1-5H2,(H2,18,21,22) |
| InChIKey | ZXALXMFBFYROAI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |