C7H9ClO — CID 22747502
5-chloro-1-methoxycyclohexa-1,3-diene (PubChem CID 22747502) has the molecular formula C7H9ClO and a molecular weight of 144.60 g/mol. Its IUPAC name is 5-chloro-1-methoxycyclohexa-1,3-diene.
| Compound Name | 5-chloro-1-methoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 22747502 |
| Molecular Formula | C7H9ClO |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.03 |
| IUPAC Name | 5-chloro-1-methoxycyclohexa-1,3-diene |
| SMILES | COC1=CC=CC(Cl)C1 |
| InChI | InChI=1S/C7H9ClO/c1-9-7-4-2-3-6(8)5-7/h2-4,6H,5H2,1H3 |
| InChIKey | NIWSUJCAWITGFY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|