C8H12Cl6O3P+ — CID 22748458
oxo-bis(1,1,2-trichlorobutoxy)phosphanium (PubChem CID 22748458) has the molecular formula C8H12Cl6O3P+ and a molecular weight of 399.87 g/mol. Its IUPAC name is oxo-bis(1,1,2-trichlorobutoxy)phosphanium.
| Compound Name | oxo-bis(1,1,2-trichlorobutoxy)phosphanium |
|---|---|
| PubChem CID | 22748458 |
| Molecular Formula | C8H12Cl6O3P+ |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 396.86 |
| IUPAC Name | oxo-bis(1,1,2-trichlorobutoxy)phosphanium |
| SMILES | CCC(Cl)C(Cl)(Cl)O[P+](=O)OC(Cl)(Cl)C(Cl)CC |
| InChI | InChI=1S/C8H12Cl6O3P/c1-3-5(9)7(11,12)16-18(15)17-8(13,14)6(10)4-2/h5-6H,3-4H2,1-2H3/q+1 |
| InChIKey | ZMRSWCJSWUJTLU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|