C20H34Cl4O3P+ — CID 173453852
bis(3,8-dichlorodec-5-en-5-yloxy)-oxophosphanium (PubChem CID 173453852) has the molecular formula C20H34Cl4O3P+ and a molecular weight of 495.28 g/mol. Its IUPAC name is bis(3,8-dichlorodec-5-en-5-yloxy)-oxophosphanium.
| Compound Name | bis(3,8-dichlorodec-5-en-5-yloxy)-oxophosphanium |
|---|---|
| PubChem CID | 173453852 |
| Molecular Formula | C20H34Cl4O3P+ |
| Molecular Weight | 495.28 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | bis(3,8-dichlorodec-5-en-5-yloxy)-oxophosphanium |
| SMILES | CCC(Cl)CC=C(CC(Cl)CC)O[P+](=O)OC(=CCC(Cl)CC)CC(Cl)CC |
| InChI | InChI=1S/C20H34Cl4O3P/c1-5-15(21)9-11-19(13-17(23)7-3)26-28(25)27-20(14-18(24)8-4)12-10-16(22)6-2/h11-12,15-18H,5-10,13-14H2,1-4H3/q+1 |
| InChIKey | HQIAUXXIWJULPE-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.28 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|