C14H29BrO — CID 22749754
10-bromo-2-methoxy-2,6-dimethylundecane (PubChem CID 22749754) has the molecular formula C14H29BrO and a molecular weight of 293.29 g/mol. Its IUPAC name is 10-bromo-2-methoxy-2,6-dimethylundecane.
| Compound Name | 10-bromo-2-methoxy-2,6-dimethylundecane |
|---|---|
| PubChem CID | 22749754 |
| Molecular Formula | C14H29BrO |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 10-bromo-2-methoxy-2,6-dimethylundecane |
| SMILES | COC(C)(C)CCCC(C)CCCC(C)Br |
| InChI | InChI=1S/C14H29BrO/c1-12(8-6-10-13(2)15)9-7-11-14(3,4)16-5/h12-13H,6-11H2,1-5H3 |
| InChIKey | BMZGCLVKPKGQJA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|