About 10-bromo-2-methoxy-2,6-dimethylundecane
10-bromo-2-methoxy-2,6-dimethylundecane (PubChem CID 22749754) has the molecular formula C14H29BrO
and a molecular weight of 293.29 g/mol. Its IUPAC name is 10-bromo-2-methoxy-2,6-dimethylundecane.
Molecular Properties
| Compound Name | 10-bromo-2-methoxy-2,6-dimethylundecane |
| PubChem CID | 22749754 |
| Molecular Formula | C14H29BrO |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 10-bromo-2-methoxy-2,6-dimethylundecane |
| SMILES | COC(C)(C)CCCC(C)CCCC(C)Br |
| InChI | InChI=1S/C14H29BrO/c1-12(8-6-10-13(2)15)9-7-11-14(3,4)16-5/h12-13H,6-11H2,1-5H3 |
| InChIKey | BMZGCLVKPKGQJA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 10-bromo-2-methoxy-2,6-dimethylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-bromo-2-methoxy-2,6-dimethylundecane?
The IUPAC name of 10-bromo-2-methoxy-2,6-dimethylundecane (CID 22749754) is 10-bromo-2-methoxy-2,6-dimethylundecane.
What is the SMILES notation for 10-bromo-2-methoxy-2,6-dimethylundecane?
The canonical SMILES for 10-bromo-2-methoxy-2,6-dimethylundecane is COC(C)(C)CCCC(C)CCCC(C)Br.
What is the InChIKey of 10-bromo-2-methoxy-2,6-dimethylundecane?
The InChIKey is BMZGCLVKPKGQJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29BrO/c1-12(8-6-10-13(2)15)9-7-11-14(3,4)16-5/h12-13H,6-11H2,1-5H3.
What are the key properties of 10-bromo-2-methoxy-2,6-dimethylundecane?
10-bromo-2-methoxy-2,6-dimethylundecane has a molecular weight of 293.29 g/mol, XLogP of 5.17, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-bromo-2-methoxy-2,6-dimethylundecane is sourced from PubChem (CID 22749754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).