C22H20N2O3S — CID 22750889
1-(2,2-diphenylethenylsulfonyl)-3-(4-methylphenyl)urea (PubChem CID 22750889) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 1-(2,2-diphenylethenylsulfonyl)-3-(4-methylphenyl)urea.
| Compound Name | 1-(2,2-diphenylethenylsulfonyl)-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 22750889 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 1-(2,2-diphenylethenylsulfonyl)-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NS(=O)(=O)C=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N2O3S/c1-17-12-14-20(15-13-17)23-22(25)24-28(26,27)16-21(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-16H,1H3,(H2,23,24,25) |
| InChIKey | XADCVPJXZUFJOD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |