About 6-phenyl-3,4-dihydropyridine
6-phenyl-3,4-dihydropyridine (PubChem CID 22751216) has the molecular formula C11H11N
and a molecular weight of 157.22 g/mol. Its IUPAC name is 6-phenyl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 6-phenyl-3,4-dihydropyridine |
| PubChem CID | 22751216 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 6-phenyl-3,4-dihydropyridine |
| SMILES | C1=NC(c2ccccc2)=CCC1 |
| InChI | InChI=1S/C11H11N/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h1-3,6-9H,4-5H2 |
| InChIKey | HGEDJORLEOBJLF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-phenyl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-3,4-dihydropyridine?
The IUPAC name of 6-phenyl-3,4-dihydropyridine (CID 22751216) is 6-phenyl-3,4-dihydropyridine.
What is the SMILES notation for 6-phenyl-3,4-dihydropyridine?
The canonical SMILES for 6-phenyl-3,4-dihydropyridine is C1=NC(c2ccccc2)=CCC1.
What is the InChIKey of 6-phenyl-3,4-dihydropyridine?
The InChIKey is HGEDJORLEOBJLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h1-3,6-9H,4-5H2.
What are the key properties of 6-phenyl-3,4-dihydropyridine?
6-phenyl-3,4-dihydropyridine has a molecular weight of 157.22 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-3,4-dihydropyridine is sourced from PubChem (CID 22751216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).