C24H22BrClN4O4S — CID 2275284
N-[3-[1-[2-[2-(2-bromo-N-methylsulfonylanilino)acetyl]hydrazinyl]ethenyl]phenyl]-3-chlorobenzamide (PubChem CID 2275284) has the molecular formula C24H22BrClN4O4S and a molecular weight of 577.89 g/mol. Its IUPAC name is N-[3-[1-[2-[2-(2-bromo-N-methylsulfonylanilino)acetyl]hydrazinyl]ethenyl]phenyl]-3-chlorobenzamide.
| Compound Name | N-[3-[1-[2-[2-(2-bromo-N-methylsulfonylanilino)acetyl]hydrazinyl]ethenyl]phenyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 2275284 |
| Molecular Formula | C24H22BrClN4O4S |
| Molecular Weight | 577.89 g/mol |
| Exact Mass | 576.02 |
| IUPAC Name | N-[3-[1-[2-[2-(2-bromo-N-methylsulfonylanilino)acetyl]hydrazinyl]ethenyl]phenyl]-3-chlorobenzamide |
| SMILES | C=C(NNC(=O)CN(c1ccccc1Br)S(C)(=O)=O)c1cccc(NC(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C24H22BrClN4O4S/c1-16(17-7-6-10-20(14-17)27-24(32)18-8-5-9-19(26)13-18)28-29-23(31)15-30(35(2,33)34)22-12-4-3-11-21(22)25/h3-14,28H,1,15H2,2H3,(H,27,32)(H,29,31) |
| InChIKey | NIYPMPQFNXQGNE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.89 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|