C10H13N2O8P — CID 22754473
2-hydroxy-N-[(4-nitrophenyl)methyl]-2-oxo-N-(phosphonomethyl)ethanamine oxide (PubChem CID 22754473) has the molecular formula C10H13N2O8P and a molecular weight of 320.19 g/mol. Its IUPAC name is 2-hydroxy-N-[(4-nitrophenyl)methyl]-2-oxo-N-(phosphonomethyl)ethanamine oxide.
| Compound Name | 2-hydroxy-N-[(4-nitrophenyl)methyl]-2-oxo-N-(phosphonomethyl)ethanamine oxide |
|---|---|
| PubChem CID | 22754473 |
| Molecular Formula | C10H13N2O8P |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2-hydroxy-N-[(4-nitrophenyl)methyl]-2-oxo-N-(phosphonomethyl)ethanamine oxide |
| SMILES | O=C(O)C[N+]([O-])(Cc1ccc([N+](=O)[O-])cc1)CP(=O)(O)O |
| InChI | InChI=1S/C10H13N2O8P/c13-10(14)6-12(17,7-21(18,19)20)5-8-1-3-9(4-2-8)11(15)16/h1-4H,5-7H2,(H,13,14)(H2,18,19,20) |
| InChIKey | XROWODHERHIPCJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 161.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|