C5H8N2O2 — CID 22757021
1,2-dimethylpyrazolidine-3,4-dione (PubChem CID 22757021) has the molecular formula C5H8N2O2 and a molecular weight of 128.13 g/mol. Its IUPAC name is 1,2-dimethylpyrazolidine-3,4-dione.
| Compound Name | 1,2-dimethylpyrazolidine-3,4-dione |
|---|---|
| PubChem CID | 22757021 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 1,2-dimethylpyrazolidine-3,4-dione |
| SMILES | CN1CC(=O)C(=O)N1C |
| InChI | InChI=1S/C5H8N2O2/c1-6-3-4(8)5(9)7(6)2/h3H2,1-2H3 |
| InChIKey | DPSJLMXUMKWHGP-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|