About 1,2-dimethylpyrazolidine-3,4-dione
1,2-dimethylpyrazolidine-3,4-dione (PubChem CID 22757021) has the molecular formula C5H8N2O2
and a molecular weight of 128.13 g/mol. Its IUPAC name is 1,2-dimethylpyrazolidine-3,4-dione.
Molecular Properties
| Compound Name | 1,2-dimethylpyrazolidine-3,4-dione |
| PubChem CID | 22757021 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 1,2-dimethylpyrazolidine-3,4-dione |
| SMILES | CN1CC(=O)C(=O)N1C |
| InChI | InChI=1S/C5H8N2O2/c1-6-3-4(8)5(9)7(6)2/h3H2,1-2H3 |
| InChIKey | DPSJLMXUMKWHGP-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethylpyrazolidine-3,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylpyrazolidine-3,4-dione?
The IUPAC name of 1,2-dimethylpyrazolidine-3,4-dione (CID 22757021) is 1,2-dimethylpyrazolidine-3,4-dione.
What is the SMILES notation for 1,2-dimethylpyrazolidine-3,4-dione?
The canonical SMILES for 1,2-dimethylpyrazolidine-3,4-dione is CN1CC(=O)C(=O)N1C.
What is the InChIKey of 1,2-dimethylpyrazolidine-3,4-dione?
The InChIKey is DPSJLMXUMKWHGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O2/c1-6-3-4(8)5(9)7(6)2/h3H2,1-2H3.
What are the key properties of 1,2-dimethylpyrazolidine-3,4-dione?
1,2-dimethylpyrazolidine-3,4-dione has a molecular weight of 128.13 g/mol, XLogP of -1.13, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylpyrazolidine-3,4-dione is sourced from PubChem (CID 22757021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).