C6H12N2O2 — CID 59946822
N,N',N'-trimethyl-2-oxopropanehydrazide (PubChem CID 59946822) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is N,N',N'-trimethyl-2-oxopropanehydrazide.
| Compound Name | N,N',N'-trimethyl-2-oxopropanehydrazide |
|---|---|
| PubChem CID | 59946822 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | N,N',N'-trimethyl-2-oxopropanehydrazide |
| SMILES | CC(=O)C(=O)N(C)N(C)C |
| InChI | InChI=1S/C6H12N2O2/c1-5(9)6(10)8(4)7(2)3/h1-4H3 |
| InChIKey | WSZZNJJEYTUINU-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|