C17H20N2OS — CID 22758880
4-benzhydrylsulfanyl-N'-hydroxybutanimidamide (PubChem CID 22758880) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is 4-benzhydrylsulfanyl-N'-hydroxybutanimidamide.
| Compound Name | 4-benzhydrylsulfanyl-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 22758880 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4-benzhydrylsulfanyl-N'-hydroxybutanimidamide |
| SMILES | N/C(CCCSC(c1ccccc1)c1ccccc1)=N\O |
| InChI | InChI=1S/C17H20N2OS/c18-16(19-20)12-7-13-21-17(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,17,20H,7,12-13H2,(H2,18,19) |
| InChIKey | ARMFRAZZCHYKLO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|