C16H18N2OS — CID 22758894
3-benzhydrylsulfanyl-N'-hydroxypropanimidamide (PubChem CID 22758894) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is 3-benzhydrylsulfanyl-N'-hydroxypropanimidamide.
| Compound Name | 3-benzhydrylsulfanyl-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 22758894 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-benzhydrylsulfanyl-N'-hydroxypropanimidamide |
| SMILES | N/C(CCSC(c1ccccc1)c1ccccc1)=N\O |
| InChI | InChI=1S/C16H18N2OS/c17-15(18-19)11-12-20-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,16,19H,11-12H2,(H2,17,18) |
| InChIKey | PSEPMLXGDZFYQS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|