About [4-(hydroxycarbamoylamino)phenyl] 4-propan-2-ylbenzoate
[4-(hydroxycarbamoylamino)phenyl] 4-propan-2-ylbenzoate (PubChem CID 22762252) has the molecular formula C17H18N2O4
and a molecular weight of 314.34 g/mol. Its IUPAC name is [4-(hydroxycarbamoylamino)phenyl] 4-propan-2-ylbenzoate.
Molecular Properties
| Compound Name | [4-(hydroxycarbamoylamino)phenyl] 4-propan-2-ylbenzoate |
| PubChem CID | 22762252 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | [4-(hydroxycarbamoylamino)phenyl] 4-propan-2-ylbenzoate |
| SMILES | CC(C)c1ccc(C(=O)Oc2ccc(NC(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C17H18N2O4/c1-11(2)12-3-5-13(6-4-12)16(20)23-15-9-7-14(8-10-15)18-17(21)19-22/h3-11,22H,1-2H3,(H2,18,19,21) |
| InChIKey | QJQLRNNZTVAZRS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(hydroxycarbamoylamino)phenyl] 4-propan-2-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(hydroxycarbamoylamino)phenyl] 4-propan-2-ylbenzoate?
The IUPAC name of [4-(hydroxycarbamoylamino)phenyl] 4-propan-2-ylbenzoate (CID 22762252) is [4-(hydroxycarbamoylamino)phenyl] 4-propan-2-ylbenzoate.
What is the SMILES notation for [4-(hydroxycarbamoylamino)phenyl] 4-propan-2-ylbenzoate?
The canonical SMILES for [4-(hydroxycarbamoylamino)phenyl] 4-propan-2-ylbenzoate is CC(C)c1ccc(C(=O)Oc2ccc(NC(=O)NO)cc2)cc1.
What is the InChIKey of [4-(hydroxycarbamoylamino)phenyl] 4-propan-2-ylbenzoate?
The InChIKey is QJQLRNNZTVAZRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O4/c1-11(2)12-3-5-13(6-4-12)16(20)23-15-9-7-14(8-10-15)18-17(21)19-22/h3-11,22H,1-2H3,(H2,18,19,21).
What are the key properties of [4-(hydroxycarbamoylamino)phenyl] 4-propan-2-ylbenzoate?
[4-(hydroxycarbamoylamino)phenyl] 4-propan-2-ylbenzoate has a molecular weight of 314.34 g/mol, XLogP of 3.54, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(hydroxycarbamoylamino)phenyl] 4-propan-2-ylbenzoate is sourced from PubChem (CID 22762252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).