C20H22O3 — CID 2276382
(7S)-2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione (PubChem CID 2276382) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is (7S)-2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione.
| Compound Name | (7S)-2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione |
|---|---|
| PubChem CID | 2276382 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (7S)-2-butyl-3-methyl-7-phenyl-7,8-dihydro-6H-chromene-4,5-dione |
| SMILES | CCCCc1oc2c(c(=O)c1C)C(=O)C[C@@H](c1ccccc1)C2 |
| InChI | InChI=1S/C20H22O3/c1-3-4-10-17-13(2)20(22)19-16(21)11-15(12-18(19)23-17)14-8-6-5-7-9-14/h5-9,15H,3-4,10-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | LZZDOJDUUQQOKA-OAHLLOKOSA-N |
| XLogP | 4.20 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |