C13H11Cl2NS — CID 22764664
2-[1-(2,5-dichlorophenyl)ethylsulfanyl]pyridine (PubChem CID 22764664) has the molecular formula C13H11Cl2NS and a molecular weight of 284.21 g/mol. Its IUPAC name is 2-[1-(2,5-dichlorophenyl)ethylsulfanyl]pyridine.
| Compound Name | 2-[1-(2,5-dichlorophenyl)ethylsulfanyl]pyridine |
|---|---|
| PubChem CID | 22764664 |
| Molecular Formula | C13H11Cl2NS |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 2-[1-(2,5-dichlorophenyl)ethylsulfanyl]pyridine |
| SMILES | CC(Sc1ccccn1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H11Cl2NS/c1-9(17-13-4-2-3-7-16-13)11-8-10(14)5-6-12(11)15/h2-9H,1H3 |
| InChIKey | VMPLZIDAUGOMSR-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |