C14H19NOS — CID 22765102
S-(3-methylphenyl) N-(2-methylcyclopentyl)carbamothioate (PubChem CID 22765102) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is S-(3-methylphenyl) N-(2-methylcyclopentyl)carbamothioate.
| Compound Name | S-(3-methylphenyl) N-(2-methylcyclopentyl)carbamothioate |
|---|---|
| PubChem CID | 22765102 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | S-(3-methylphenyl) N-(2-methylcyclopentyl)carbamothioate |
| SMILES | Cc1cccc(SC(=O)NC2CCCC2C)c1 |
| InChI | InChI=1S/C14H19NOS/c1-10-5-3-7-12(9-10)17-14(16)15-13-8-4-6-11(13)2/h3,5,7,9,11,13H,4,6,8H2,1-2H3,(H,15,16) |
| InChIKey | KMOJAFLLZJLNCQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|