About methyl 7-oxobicyclo[3.1.1]hepta-1(6),2,4-triene-3-carboxylate chloride
methyl 7-oxobicyclo[3.1.1]hepta-1(6),2,4-triene-3-carboxylate chloride (PubChem CID 22765130) has the molecular formula C9H6ClO3-
and a molecular weight of 197.60 g/mol. Its IUPAC name is methyl 7-oxobicyclo[3.1.1]hepta-1(6),2,4-triene-3-carboxylate chloride.
Analyze methyl 7-oxobicyclo[3.1.1]hepta-1(6),2,4-triene-3-carboxylate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-oxobicyclo[3.1.1]hepta-1(6),2,4-triene-3-carboxylate chloride?
The IUPAC name of methyl 7-oxobicyclo[3.1.1]hepta-1(6),2,4-triene-3-carboxylate chloride (CID 22765130) is methyl 7-oxobicyclo[3.1.1]hepta-1(6),2,4-triene-3-carboxylate chloride.
What is the SMILES notation for methyl 7-oxobicyclo[3.1.1]hepta-1(6),2,4-triene-3-carboxylate chloride?
The canonical SMILES for methyl 7-oxobicyclo[3.1.1]hepta-1(6),2,4-triene-3-carboxylate chloride is COC(=O)c1cc2cc(c1)C2=O.[Cl-].
What is the InChIKey of methyl 7-oxobicyclo[3.1.1]hepta-1(6),2,4-triene-3-carboxylate chloride?
The InChIKey is IXMYWYQRLRXIDK-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H6O3.ClH/c1-12-9(11)7-3-5-2-6(4-7)8(5)10;/h2-4H,1H3;1H/p-1.
What are the key properties of methyl 7-oxobicyclo[3.1.1]hepta-1(6),2,4-triene-3-carboxylate chloride?
methyl 7-oxobicyclo[3.1.1]hepta-1(6),2,4-triene-3-carboxylate chloride has a molecular weight of 197.60 g/mol, XLogP of -1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-oxobicyclo[3.1.1]hepta-1(6),2,4-triene-3-carboxylate chloride is sourced from PubChem (CID 22765130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).