methyl 3-(3,5-dichlorophenyl)-5-hydroxybenzoate

C14H10Cl2O3 — CID 146243627

IUPACmethyl 3-(3,5-dichlorophenyl)-5-hydroxybenzoate
SMILESCOC(=O)c1cc(O)cc(-c2cc(Cl)cc(Cl)c2)c1
InChIInChI=1S/C14H10Cl2O3/c1-19-14(18)10-2-8(5-13(17)6-10)9-3-11(15)7-12(16)4-9/h2-7,17H,1H3
InChIKeyYMNPNAPFQCAWJO-UHFFFAOYSA-N
MW297.14 g/mol
LogP4.15
Rot. Bonds2

About methyl 3-(3,5-dichlorophenyl)-5-hydroxybenzoate

methyl 3-(3,5-dichlorophenyl)-5-hydroxybenzoate (PubChem CID 146243627) has the molecular formula C14H10Cl2O3 and a molecular weight of 297.14 g/mol. Its IUPAC name is methyl 3-(3,5-dichlorophenyl)-5-hydroxybenzoate.

Molecular Properties

Compound Namemethyl 3-(3,5-dichlorophenyl)-5-hydroxybenzoate
PubChem CID146243627
Molecular FormulaC14H10Cl2O3
Molecular Weight297.14 g/mol
Exact Mass296.00
IUPAC Namemethyl 3-(3,5-dichlorophenyl)-5-hydroxybenzoate
SMILESCOC(=O)c1cc(O)cc(-c2cc(Cl)cc(Cl)c2)c1
InChIInChI=1S/C14H10Cl2O3/c1-19-14(18)10-2-8(5-13(17)6-10)9-3-11(15)7-12(16)4-9/h2-7,17H,1H3
InChIKeyYMNPNAPFQCAWJO-UHFFFAOYSA-N
XLogP4.15
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.14
LogP ≤ 54.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3-(3,5-dichlorophenyl)-5-hydroxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3,5-dichlorophenyl)-5-hydroxybenzoate?
The IUPAC name of methyl 3-(3,5-dichlorophenyl)-5-hydroxybenzoate (CID 146243627) is methyl 3-(3,5-dichlorophenyl)-5-hydroxybenzoate.
What is the SMILES notation for methyl 3-(3,5-dichlorophenyl)-5-hydroxybenzoate?
The canonical SMILES for methyl 3-(3,5-dichlorophenyl)-5-hydroxybenzoate is COC(=O)c1cc(O)cc(-c2cc(Cl)cc(Cl)c2)c1.
What is the InChIKey of methyl 3-(3,5-dichlorophenyl)-5-hydroxybenzoate?
The InChIKey is YMNPNAPFQCAWJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2O3/c1-19-14(18)10-2-8(5-13(17)6-10)9-3-11(15)7-12(16)4-9/h2-7,17H,1H3.
What are the key properties of methyl 3-(3,5-dichlorophenyl)-5-hydroxybenzoate?
methyl 3-(3,5-dichlorophenyl)-5-hydroxybenzoate has a molecular weight of 297.14 g/mol, XLogP of 4.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3,5-dichlorophenyl)-5-hydroxybenzoate is sourced from PubChem (CID 146243627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).