C21H23NO7 — CID 56973175
methyl 3-(3-hydroxy-5-methoxycarbonylphenyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate (PubChem CID 56973175) has the molecular formula C21H23NO7 and a molecular weight of 401.42 g/mol. Its IUPAC name is methyl 3-(3-hydroxy-5-methoxycarbonylphenyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate.
| Compound Name | methyl 3-(3-hydroxy-5-methoxycarbonylphenyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate |
|---|---|
| PubChem CID | 56973175 |
| Molecular Formula | C21H23NO7 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | methyl 3-(3-hydroxy-5-methoxycarbonylphenyl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate |
| SMILES | COC(=O)c1cc(O)cc(-c2cc(NC(=O)OC(C)(C)C)cc(C(=O)OC)c2)c1 |
| InChI | InChI=1S/C21H23NO7/c1-21(2,3)29-20(26)22-16-8-12(6-14(9-16)18(24)27-4)13-7-15(19(25)28-5)11-17(23)10-13/h6-11,23H,1-5H3,(H,22,26) |
| InChIKey | CDGDVSGHUWVORY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|