C18H16N2O6S2 — CID 22766967
3-(2,5-dioxopyrrolidin-1-yl)-5-[methyl(phenyl)sulfamoyl]-4-sulfanylbenzoic acid (PubChem CID 22766967) has the molecular formula C18H16N2O6S2 and a molecular weight of 420.47 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-5-[methyl(phenyl)sulfamoyl]-4-sulfanylbenzoic acid.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-5-[methyl(phenyl)sulfamoyl]-4-sulfanylbenzoic acid |
|---|---|
| PubChem CID | 22766967 |
| Molecular Formula | C18H16N2O6S2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-5-[methyl(phenyl)sulfamoyl]-4-sulfanylbenzoic acid |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cc(C(=O)O)cc(N2C(=O)CCC2=O)c1S |
| InChI | InChI=1S/C18H16N2O6S2/c1-19(12-5-3-2-4-6-12)28(25,26)14-10-11(18(23)24)9-13(17(14)27)20-15(21)7-8-16(20)22/h2-6,9-10,27H,7-8H2,1H3,(H,23,24) |
| InChIKey | DVCVMJGMEATPAG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|