C12H19N2OS2+ — CID 2277149
2-(dithiocarboxyamino)ethyl-[2-(3-methylphenoxy)ethyl]azanium (PubChem CID 2277149) has the molecular formula C12H19N2OS2+ and a molecular weight of 271.43 g/mol. Its IUPAC name is 2-(dithiocarboxyamino)ethyl-[2-(3-methylphenoxy)ethyl]azanium.
| Compound Name | 2-(dithiocarboxyamino)ethyl-[2-(3-methylphenoxy)ethyl]azanium |
|---|---|
| PubChem CID | 2277149 |
| Molecular Formula | C12H19N2OS2+ |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-(dithiocarboxyamino)ethyl-[2-(3-methylphenoxy)ethyl]azanium |
| SMILES | Cc1cccc(OCC[NH2+]CCNC(=S)S)c1 |
| InChI | InChI=1S/C12H18N2OS2/c1-10-3-2-4-11(9-10)15-8-7-13-5-6-14-12(16)17/h2-4,9,13H,5-8H2,1H3,(H2,14,16,17)/p+1 |
| InChIKey | VTTQAJMKLOHNGH-UHFFFAOYSA-O |
| XLogP | 0.74 |
| TPSA | 37.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|