C21H25N3O4S — CID 22771609
4-(1-adamantyl)-3,5-dimethyl-1-(2-nitrophenyl)sulfonylpyrazole (PubChem CID 22771609) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is 4-(1-adamantyl)-3,5-dimethyl-1-(2-nitrophenyl)sulfonylpyrazole.
| Compound Name | 4-(1-adamantyl)-3,5-dimethyl-1-(2-nitrophenyl)sulfonylpyrazole |
|---|---|
| PubChem CID | 22771609 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 4-(1-adamantyl)-3,5-dimethyl-1-(2-nitrophenyl)sulfonylpyrazole |
| SMILES | Cc1nn(S(=O)(=O)c2ccccc2[N+](=O)[O-])c(C)c1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H25N3O4S/c1-13-20(21-10-15-7-16(11-21)9-17(8-15)12-21)14(2)23(22-13)29(27,28)19-6-4-3-5-18(19)24(25)26/h3-6,15-17H,7-12H2,1-2H3 |
| InChIKey | WPYBWDVTNZKTEL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 95.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|