C21H22N2O6S — CID 2277228
ethyl (5S,6R)-4-methylidene-6-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxo-1,3-diazinane-5-carboxylate (PubChem CID 2277228) has the molecular formula C21H22N2O6S and a molecular weight of 430.48 g/mol. Its IUPAC name is ethyl (5S,6R)-4-methylidene-6-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxo-1,3-diazinane-5-carboxylate.
| Compound Name | ethyl (5S,6R)-4-methylidene-6-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxo-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 2277228 |
| Molecular Formula | C21H22N2O6S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | ethyl (5S,6R)-4-methylidene-6-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxo-1,3-diazinane-5-carboxylate |
| SMILES | C=C1NC(=O)N[C@@H](c2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C21H22N2O6S/c1-4-28-20(24)18-14(3)22-21(25)23-19(18)15-7-9-16(10-8-15)29-30(26,27)17-11-5-13(2)6-12-17/h5-12,18-19H,3-4H2,1-2H3,(H2,22,23,25)/t18-,19+/m1/s1 |
| InChIKey | YSXDKJNFTFJFJZ-MOPGFXCFSA-N |
| XLogP | 2.81 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|