C19H27N3O2S — CID 22772410
N-(4-ethylcyclohexyl)-3,5-dimethyl-1-phenylpyrazole-4-sulfonamide (PubChem CID 22772410) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is N-(4-ethylcyclohexyl)-3,5-dimethyl-1-phenylpyrazole-4-sulfonamide.
| Compound Name | N-(4-ethylcyclohexyl)-3,5-dimethyl-1-phenylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 22772410 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-(4-ethylcyclohexyl)-3,5-dimethyl-1-phenylpyrazole-4-sulfonamide |
| SMILES | CCC1CCC(NS(=O)(=O)c2c(C)nn(-c3ccccc3)c2C)CC1 |
| InChI | InChI=1S/C19H27N3O2S/c1-4-16-10-12-17(13-11-16)21-25(23,24)19-14(2)20-22(15(19)3)18-8-6-5-7-9-18/h5-9,16-17,21H,4,10-13H2,1-3H3 |
| InChIKey | ZEAOEYIHOZVYLJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |