C17H31N3O2S — CID 22772503
1-ethyl-3-methyl-N-[4-(2-methylbutan-2-yl)cyclohexyl]pyrazole-4-sulfonamide (PubChem CID 22772503) has the molecular formula C17H31N3O2S and a molecular weight of 341.52 g/mol. Its IUPAC name is 1-ethyl-3-methyl-N-[4-(2-methylbutan-2-yl)cyclohexyl]pyrazole-4-sulfonamide.
| Compound Name | 1-ethyl-3-methyl-N-[4-(2-methylbutan-2-yl)cyclohexyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 22772503 |
| Molecular Formula | C17H31N3O2S |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1-ethyl-3-methyl-N-[4-(2-methylbutan-2-yl)cyclohexyl]pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NC2CCC(C(C)(C)CC)CC2)c(C)n1 |
| InChI | InChI=1S/C17H31N3O2S/c1-6-17(4,5)14-8-10-15(11-9-14)19-23(21,22)16-12-20(7-2)18-13(16)3/h12,14-15,19H,6-11H2,1-5H3 |
| InChIKey | LSJVJEDNTCEZTB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |