C14H20N4O2S2 — CID 22772640
N-(1-propylpiperidin-4-yl)-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 22772640) has the molecular formula C14H20N4O2S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is N-(1-propylpiperidin-4-yl)-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-(1-propylpiperidin-4-yl)-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 22772640 |
| Molecular Formula | C14H20N4O2S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-(1-propylpiperidin-4-yl)-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | CCCN1CCC(NS(=O)(=O)c2cccc3nsnc23)CC1 |
| InChI | InChI=1S/C14H20N4O2S2/c1-2-8-18-9-6-11(7-10-18)17-22(19,20)13-5-3-4-12-14(13)16-21-15-12/h3-5,11,17H,2,6-10H2,1H3 |
| InChIKey | XVEPQEARKRWKQJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |