C19H18Cl2N2O2S — CID 22775450
(E)-N-[(3,5-dichloro-2-hydroxyphenyl)carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 22775450) has the molecular formula C19H18Cl2N2O2S and a molecular weight of 409.34 g/mol. Its IUPAC name is (E)-N-[(3,5-dichloro-2-hydroxyphenyl)carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(3,5-dichloro-2-hydroxyphenyl)carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 22775450 |
| Molecular Formula | C19H18Cl2N2O2S |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | (E)-N-[(3,5-dichloro-2-hydroxyphenyl)carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC(C)c1ccc(/C=C/C(=O)NC(=S)Nc2cc(Cl)cc(Cl)c2O)cc1 |
| InChI | InChI=1S/C19H18Cl2N2O2S/c1-11(2)13-6-3-12(4-7-13)5-8-17(24)23-19(26)22-16-10-14(20)9-15(21)18(16)25/h3-11,25H,1-2H3,(H2,22,23,24,26)/b8-5+ |
| InChIKey | NAVNFFBVJVUDNL-VMPITWQZSA-N |
| XLogP | 5.35 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|