C20H18Br2N2O3S — CID 3271837
3,5-dibromo-2-[3-(4-propan-2-ylphenyl)prop-2-enoylcarbamothioylamino]benzoic acid (PubChem CID 3271837) has the molecular formula C20H18Br2N2O3S and a molecular weight of 526.25 g/mol. Its IUPAC name is 3,5-dibromo-2-[3-(4-propan-2-ylphenyl)prop-2-enoylcarbamothioylamino]benzoic acid.
| Compound Name | 3,5-dibromo-2-[3-(4-propan-2-ylphenyl)prop-2-enoylcarbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 3271837 |
| Molecular Formula | C20H18Br2N2O3S |
| Molecular Weight | 526.25 g/mol |
| Exact Mass | 523.94 |
| IUPAC Name | 3,5-dibromo-2-[3-(4-propan-2-ylphenyl)prop-2-enoylcarbamothioylamino]benzoic acid |
| SMILES | CC(C)c1ccc(C=CC(=O)NC(=S)Nc2c(Br)cc(Br)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C20H18Br2N2O3S/c1-11(2)13-6-3-12(4-7-13)5-8-17(25)23-20(28)24-18-15(19(26)27)9-14(21)10-16(18)22/h3-11H,1-2H3,(H,26,27)(H2,23,24,25,28) |
| InChIKey | SULKPISNNZXNGA-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.25 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|