C22H18BrNO2S — CID 22781193
N-[4-[2-(4-bromophenyl)-2-oxoethyl]sulfanylphenyl]-2-methylbenzamide (PubChem CID 22781193) has the molecular formula C22H18BrNO2S and a molecular weight of 440.36 g/mol. Its IUPAC name is N-[4-[2-(4-bromophenyl)-2-oxoethyl]sulfanylphenyl]-2-methylbenzamide.
| Compound Name | N-[4-[2-(4-bromophenyl)-2-oxoethyl]sulfanylphenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 22781193 |
| Molecular Formula | C22H18BrNO2S |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 439.02 |
| IUPAC Name | N-[4-[2-(4-bromophenyl)-2-oxoethyl]sulfanylphenyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(SCC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H18BrNO2S/c1-15-4-2-3-5-20(15)22(26)24-18-10-12-19(13-11-18)27-14-21(25)16-6-8-17(23)9-7-16/h2-13H,14H2,1H3,(H,24,26) |
| InChIKey | FKNSJXACPHCMMW-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |