C40H37N3O6S — CID 22784409
N-[(Z)-3-oxo-3-[4-[1-oxo-1-(N-phenylanilino)propan-2-yl]sulfanylanilino]-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 22784409) has the molecular formula C40H37N3O6S and a molecular weight of 687.82 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[4-[1-oxo-1-(N-phenylanilino)propan-2-yl]sulfanylanilino]-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[4-[1-oxo-1-(N-phenylanilino)propan-2-yl]sulfanylanilino]-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22784409 |
| Molecular Formula | C40H37N3O6S |
| Molecular Weight | 687.82 g/mol |
| Exact Mass | 687.24 |
| IUPAC Name | N-[(Z)-3-oxo-3-[4-[1-oxo-1-(N-phenylanilino)propan-2-yl]sulfanylanilino]-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1cc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C)C(=O)N(c3ccccc3)c3ccccc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C40H37N3O6S/c1-27(40(46)43(31-16-10-6-11-17-31)32-18-12-7-13-19-32)50-33-22-20-30(21-23-33)41-39(45)34(42-38(44)29-14-8-5-9-15-29)24-28-25-35(47-2)37(49-4)36(26-28)48-3/h5-27H,1-4H3,(H,41,45)(H,42,44)/b34-24- |
| InChIKey | NYWZZOJTAUZCKJ-BCJTWVECSA-N |
| XLogP | 7.97 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.82 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|