C21H16N2O2 — CID 2278456
(4Z)-4-[(4-hydroxyphenyl)methylidene]-5-methylidene-2-naphthalen-2-ylpyrazolidin-3-one (PubChem CID 2278456) has the molecular formula C21H16N2O2 and a molecular weight of 328.37 g/mol. Its IUPAC name is (4Z)-4-[(4-hydroxyphenyl)methylidene]-5-methylidene-2-naphthalen-2-ylpyrazolidin-3-one.
| Compound Name | (4Z)-4-[(4-hydroxyphenyl)methylidene]-5-methylidene-2-naphthalen-2-ylpyrazolidin-3-one |
|---|---|
| PubChem CID | 2278456 |
| Molecular Formula | C21H16N2O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (4Z)-4-[(4-hydroxyphenyl)methylidene]-5-methylidene-2-naphthalen-2-ylpyrazolidin-3-one |
| SMILES | C=c1[nH]n(-c2ccc3ccccc3c2)c(=O)/c1=C\c1ccc(O)cc1 |
| InChI | InChI=1S/C21H16N2O2/c1-14-20(12-15-6-10-19(24)11-7-15)21(25)23(22-14)18-9-8-16-4-2-3-5-17(16)13-18/h2-13,22,24H,1H2/b20-12- |
| InChIKey | ZAOHJUXYXWUTQM-NDENLUEZSA-N |
| XLogP | 2.26 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |