C19H10Cl3N2O6- — CID 2278618
2-[2-chloro-4-[(Z)-[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetate (PubChem CID 2278618) has the molecular formula C19H10Cl3N2O6- and a molecular weight of 468.66 g/mol. Its IUPAC name is 2-[2-chloro-4-[(Z)-[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[2-chloro-4-[(Z)-[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 2278618 |
| Molecular Formula | C19H10Cl3N2O6- |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 466.96 |
| IUPAC Name | 2-[2-chloro-4-[(Z)-[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccc(/C=C2/C(=O)NC(=O)N(c3ccc(Cl)cc3Cl)C2=O)cc1Cl |
| InChI | InChI=1S/C19H11Cl3N2O6/c20-10-2-3-14(12(21)7-10)24-18(28)11(17(27)23-19(24)29)5-9-1-4-15(13(22)6-9)30-8-16(25)26/h1-7H,8H2,(H,25,26)(H,23,27,29)/p-1/b11-5- |
| InChIKey | YABYFDRDESRJQJ-WZUFQYTHSA-M |
| XLogP | 2.44 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|