C20H13Cl2N3O5 — CID 3662865
2-[4-[[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]acetonitrile (PubChem CID 3662865) has the molecular formula C20H13Cl2N3O5 and a molecular weight of 446.25 g/mol. Its IUPAC name is 2-[4-[[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]acetonitrile.
| Compound Name | 2-[4-[[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 3662865 |
| Molecular Formula | C20H13Cl2N3O5 |
| Molecular Weight | 446.25 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 2-[4-[[1-(2,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]acetonitrile |
| SMILES | COc1cc(C=C2C(=O)NC(=O)N(c3ccc(Cl)cc3Cl)C2=O)ccc1OCC#N |
| InChI | InChI=1S/C20H13Cl2N3O5/c1-29-17-9-11(2-5-16(17)30-7-6-23)8-13-18(26)24-20(28)25(19(13)27)15-4-3-12(21)10-14(15)22/h2-5,8-10H,7H2,1H3,(H,24,26,28) |
| InChIKey | PGRYOFAYXGEYLT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.25 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|