C21H16BrN3O5 — CID 3429249
2-[4-[[1-(4-bromo-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]acetonitrile (PubChem CID 3429249) has the molecular formula C21H16BrN3O5 and a molecular weight of 470.28 g/mol. Its IUPAC name is 2-[4-[[1-(4-bromo-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]acetonitrile.
| Compound Name | 2-[4-[[1-(4-bromo-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 3429249 |
| Molecular Formula | C21H16BrN3O5 |
| Molecular Weight | 470.28 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | 2-[4-[[1-(4-bromo-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]acetonitrile |
| SMILES | COc1cc(C=C2C(=O)NC(=O)N(c3ccc(Br)cc3C)C2=O)ccc1OCC#N |
| InChI | InChI=1S/C21H16BrN3O5/c1-12-9-14(22)4-5-16(12)25-20(27)15(19(26)24-21(25)28)10-13-3-6-17(30-8-7-23)18(11-13)29-2/h3-6,9-11H,8H2,1-2H3,(H,24,26,28) |
| InChIKey | BMDPEXDWPAPYOU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|