C30H23N3O3 — CID 22787783
N-[(Z)-3-oxo-3-[4-[(E)-3-phenylprop-2-enoyl]anilino]-1-pyridin-3-ylprop-1-en-2-yl]benzamide (PubChem CID 22787783) has the molecular formula C30H23N3O3 and a molecular weight of 473.53 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[4-[(E)-3-phenylprop-2-enoyl]anilino]-1-pyridin-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[4-[(E)-3-phenylprop-2-enoyl]anilino]-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22787783 |
| Molecular Formula | C30H23N3O3 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | N-[(Z)-3-oxo-3-[4-[(E)-3-phenylprop-2-enoyl]anilino]-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)/C=C/c2ccccc2)cc1)/C(=C/c1cccnc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H23N3O3/c34-28(18-13-22-8-3-1-4-9-22)24-14-16-26(17-15-24)32-30(36)27(20-23-10-7-19-31-21-23)33-29(35)25-11-5-2-6-12-25/h1-21H,(H,32,36)(H,33,35)/b18-13+,27-20- |
| InChIKey | LAFPMXTXHRZLGF-OSOZLJFVSA-N |
| XLogP | 5.39 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|