C34H29BrN2O3 — CID 23094782
N-[(Z)-1-(4-bromophenyl)-3-oxo-3-[4-[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]anilino]prop-1-en-2-yl]benzamide (PubChem CID 23094782) has the molecular formula C34H29BrN2O3 and a molecular weight of 593.52 g/mol. Its IUPAC name is N-[(Z)-1-(4-bromophenyl)-3-oxo-3-[4-[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]anilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-bromophenyl)-3-oxo-3-[4-[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]anilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 23094782 |
| Molecular Formula | C34H29BrN2O3 |
| Molecular Weight | 593.52 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | N-[(Z)-1-(4-bromophenyl)-3-oxo-3-[4-[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]anilino]prop-1-en-2-yl]benzamide |
| SMILES | CC(C)c1ccc(/C=C/C(=O)c2ccc(NC(=O)/C(=C/c3ccc(Br)cc3)NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C34H29BrN2O3/c1-23(2)26-13-8-24(9-14-26)12-21-32(38)27-15-19-30(20-16-27)36-34(40)31(22-25-10-17-29(35)18-11-25)37-33(39)28-6-4-3-5-7-28/h3-23H,1-2H3,(H,36,40)(H,37,39)/b21-12+,31-22- |
| InChIKey | FBPLQAAKSKGWRW-IGFOZBIYSA-N |
| XLogP | 7.88 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.52 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|