C16H14Cl3FN2O2S — CID 2279123
1-(4-fluorophenyl)-4-(2,3,4-trichlorophenyl)sulfonylpiperazine (PubChem CID 2279123) has the molecular formula C16H14Cl3FN2O2S and a molecular weight of 423.72 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(2,3,4-trichlorophenyl)sulfonylpiperazine.
| Compound Name | 1-(4-fluorophenyl)-4-(2,3,4-trichlorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 2279123 |
| Molecular Formula | C16H14Cl3FN2O2S |
| Molecular Weight | 423.72 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(2,3,4-trichlorophenyl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc(Cl)c(Cl)c1Cl)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H14Cl3FN2O2S/c17-13-5-6-14(16(19)15(13)18)25(23,24)22-9-7-21(8-10-22)12-3-1-11(20)2-4-12/h1-6H,7-10H2 |
| InChIKey | IFBKDYVJFLWSNA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.72 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|