C32H36ClN2O5S+ — CID 22793998
[(2S,3R,5S,6R)-2-benzhydryloxycarbonyl-3-(chloromethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-oxo-(2,6,6-trimethylbicyclo[3.1.1]heptane-2-carbonyl)azanium (PubChem CID 22793998) has the molecular formula C32H36ClN2O5S+ and a molecular weight of 596.17 g/mol. Its IUPAC name is [(2S,3R,5S,6R)-2-benzhydryloxycarbonyl-3-(chloromethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-oxo-(2,6,6-trimethylbicyclo[3.1.1]heptane-2-carbonyl)azanium.
| Compound Name | [(2S,3R,5S,6R)-2-benzhydryloxycarbonyl-3-(chloromethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-oxo-(2,6,6-trimethylbicyclo[3.1.1]heptane-2-carbonyl)azanium |
|---|---|
| PubChem CID | 22793998 |
| Molecular Formula | C32H36ClN2O5S+ |
| Molecular Weight | 596.17 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | [(2S,3R,5S,6R)-2-benzhydryloxycarbonyl-3-(chloromethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-oxo-(2,6,6-trimethylbicyclo[3.1.1]heptane-2-carbonyl)azanium |
| SMILES | CC1(C(=O)[N+](=O)[C@@H]2C(=O)N3[C@@H](C(=O)OC(c4ccccc4)c4ccccc4)[C@](C)(CCl)S[C@@H]23)CCC2CC1C2(C)C |
| InChI | InChI=1S/C32H36ClN2O5S/c1-30(2)21-15-16-31(3,22(30)17-21)29(38)35(39)23-26(36)34-25(32(4,18-33)41-27(23)34)28(37)40-24(19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,21-25,27H,15-18H2,1-4H3/q+1/t21?,22?,23-,25+,27+,31?,32+/m1/s1 |
| InChIKey | GZWOGVFBBQNVDP-QRBKYWSQSA-N |
| XLogP | 5.74 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.17 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|