C24H31N3O8S — CID 22794571
2,2-dimethylpropanoyloxymethyl (2S,5R,6R)-6-[[2-amino-3-(1,3-benzodioxol-5-yl)propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 22794571) has the molecular formula C24H31N3O8S and a molecular weight of 521.59 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (2S,5R,6R)-6-[[2-amino-3-(1,3-benzodioxol-5-yl)propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (2S,5R,6R)-6-[[2-amino-3-(1,3-benzodioxol-5-yl)propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 22794571 |
| Molecular Formula | C24H31N3O8S |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (2S,5R,6R)-6-[[2-amino-3-(1,3-benzodioxol-5-yl)propanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)[C@@H]1N2C(=O)[C@@H](NC(=O)C(N)Cc3ccc4c(c3)OCO4)[C@H]2SC1(C)C |
| InChI | InChI=1S/C24H31N3O8S/c1-23(2,3)22(31)35-11-34-21(30)17-24(4,5)36-20-16(19(29)27(17)20)26-18(28)13(25)8-12-6-7-14-15(9-12)33-10-32-14/h6-7,9,13,16-17,20H,8,10-11,25H2,1-5H3,(H,26,28)/t13?,16-,17+,20-/m1/s1 |
| InChIKey | DLUALMJHUVRNCE-XDQHQWTQSA-N |
| XLogP | 0.92 |
| TPSA | 146.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|