C26H32N4O6S — CID 11584547
2,2-dimethylpropanoyloxymethyl (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[3-(quinolin-8-ylamino)propanoylamino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 11584547) has the molecular formula C26H32N4O6S and a molecular weight of 528.63 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[3-(quinolin-8-ylamino)propanoylamino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[3-(quinolin-8-ylamino)propanoylamino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 11584547 |
| Molecular Formula | C26H32N4O6S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[3-(quinolin-8-ylamino)propanoylamino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)[C@@H]1N2C(=O)[C@@H](NC(=O)CCNc3cccc4cccnc34)[C@H]2SC1(C)C |
| InChI | InChI=1S/C26H32N4O6S/c1-25(2,3)24(34)36-14-35-23(33)20-26(4,5)37-22-19(21(32)30(20)22)29-17(31)11-13-27-16-10-6-8-15-9-7-12-28-18(15)16/h6-10,12,19-20,22,27H,11,13-14H2,1-5H3,(H,29,31)/t19-,20+,22-/m1/s1 |
| InChIKey | OUZCGIDWCSHSRQ-RZUBCFFCSA-N |
| XLogP | 2.67 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|